C15H24N4O6 — CID 2487006
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 2487006) has the molecular formula C15H24N4O6 and a molecular weight of 356.38 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 2487006 |
| Molecular Formula | C15H24N4O6 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 2-(4,4-diethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CCC1(CC)NC(=O)N(CC(=O)OCC(=O)NC(=O)NC(C)C)C1=O |
| InChI | InChI=1S/C15H24N4O6/c1-5-15(6-2)12(22)19(14(24)18-15)7-11(21)25-8-10(20)17-13(23)16-9(3)4/h9H,5-8H2,1-4H3,(H,18,24)(H2,16,17,20,23) |
| InChIKey | JYKWWTIMVKPGAS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|