About 2-phenyl-2,8a-dihydroindeno[2,1-b]pyran
2-phenyl-2,8a-dihydroindeno[2,1-b]pyran (PubChem CID 24870240) has the molecular formula C18H14O
and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-phenyl-2,8a-dihydroindeno[2,1-b]pyran.
Molecular Properties
| Compound Name | 2-phenyl-2,8a-dihydroindeno[2,1-b]pyran |
| PubChem CID | 24870240 |
| Molecular Formula | C18H14O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-phenyl-2,8a-dihydroindeno[2,1-b]pyran |
| SMILES | C1=CC2=C3C=CC(c4ccccc4)OC3=CC2C=C1 |
| InChI | InChI=1S/C18H14O/c1-2-6-13(7-3-1)17-11-10-16-15-9-5-4-8-14(15)12-18(16)19-17/h1-12,14,17H |
| InChIKey | NEHLCAMNGMPKBI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenyl-2,8a-dihydroindeno[2,1-b]pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-2,8a-dihydroindeno[2,1-b]pyran?
The IUPAC name of 2-phenyl-2,8a-dihydroindeno[2,1-b]pyran (CID 24870240) is 2-phenyl-2,8a-dihydroindeno[2,1-b]pyran.
What is the SMILES notation for 2-phenyl-2,8a-dihydroindeno[2,1-b]pyran?
The canonical SMILES for 2-phenyl-2,8a-dihydroindeno[2,1-b]pyran is C1=CC2=C3C=CC(c4ccccc4)OC3=CC2C=C1.
What is the InChIKey of 2-phenyl-2,8a-dihydroindeno[2,1-b]pyran?
The InChIKey is NEHLCAMNGMPKBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O/c1-2-6-13(7-3-1)17-11-10-16-15-9-5-4-8-14(15)12-18(16)19-17/h1-12,14,17H.
What are the key properties of 2-phenyl-2,8a-dihydroindeno[2,1-b]pyran?
2-phenyl-2,8a-dihydroindeno[2,1-b]pyran has a molecular weight of 246.31 g/mol, XLogP of 4.25, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2,8a-dihydroindeno[2,1-b]pyran is sourced from PubChem (CID 24870240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).