C14H24N+ — CID 24870289
3,3-diethyl-1,2-dimethyl-4,5,6,7-tetrahydroindol-1-ium (PubChem CID 24870289) has the molecular formula C14H24N+ and a molecular weight of 206.35 g/mol. Its IUPAC name is 3,3-diethyl-1,2-dimethyl-4,5,6,7-tetrahydroindol-1-ium.
| Compound Name | 3,3-diethyl-1,2-dimethyl-4,5,6,7-tetrahydroindol-1-ium |
|---|---|
| PubChem CID | 24870289 |
| Molecular Formula | C14H24N+ |
| Molecular Weight | 206.35 g/mol |
| Exact Mass | 206.19 |
| IUPAC Name | 3,3-diethyl-1,2-dimethyl-4,5,6,7-tetrahydroindol-1-ium |
| SMILES | CCC1(CC)C2=C(CCCC2)[N+](C)=C1C |
| InChI | InChI=1S/C14H24N/c1-5-14(6-2)11(3)15(4)13-10-8-7-9-12(13)14/h5-10H2,1-4H3/q+1 |
| InChIKey | PNIGSNHZHLGKAP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|