C17H24F3N — CID 24870421
N-[2-(trifluoromethyl)cyclohexyl]-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-imine (PubChem CID 24870421) has the molecular formula C17H24F3N and a molecular weight of 299.38 g/mol. Its IUPAC name is N-[2-(trifluoromethyl)cyclohexyl]-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-imine.
| Compound Name | N-[2-(trifluoromethyl)cyclohexyl]-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-imine |
|---|---|
| PubChem CID | 24870421 |
| Molecular Formula | C17H24F3N |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | N-[2-(trifluoromethyl)cyclohexyl]-3,4,5,6,7,8-hexahydro-2H-naphthalen-1-imine |
| SMILES | FC(F)(F)C1CCCCC1/N=C1\CCCC2=C1CCCC2 |
| InChI | InChI=1S/C17H24F3N/c18-17(19,20)14-9-3-4-10-16(14)21-15-11-5-7-12-6-1-2-8-13(12)15/h14,16H,1-11H2/b21-15+ |
| InChIKey | ARCSAXNKVHEXMU-RCCKNPSSSA-N |
| XLogP | 5.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|