About 3,4-dibenzyl-3H-1,2,4-triazole-5-thione
3,4-dibenzyl-3H-1,2,4-triazole-5-thione (PubChem CID 24870433) has the molecular formula C16H15N3S
and a molecular weight of 281.38 g/mol. Its IUPAC name is 3,4-dibenzyl-3H-1,2,4-triazole-5-thione.
Molecular Properties
| Compound Name | 3,4-dibenzyl-3H-1,2,4-triazole-5-thione |
| PubChem CID | 24870433 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3,4-dibenzyl-3H-1,2,4-triazole-5-thione |
| SMILES | S=C1N=NC(Cc2ccccc2)N1Cc1ccccc1 |
| InChI | InChI=1S/C16H15N3S/c20-16-18-17-15(11-13-7-3-1-4-8-13)19(16)12-14-9-5-2-6-10-14/h1-10,15H,11-12H2 |
| InChIKey | SQFCQFMYNPXTPK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dibenzyl-3H-1,2,4-triazole-5-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibenzyl-3H-1,2,4-triazole-5-thione?
The IUPAC name of 3,4-dibenzyl-3H-1,2,4-triazole-5-thione (CID 24870433) is 3,4-dibenzyl-3H-1,2,4-triazole-5-thione.
What is the SMILES notation for 3,4-dibenzyl-3H-1,2,4-triazole-5-thione?
The canonical SMILES for 3,4-dibenzyl-3H-1,2,4-triazole-5-thione is S=C1N=NC(Cc2ccccc2)N1Cc1ccccc1.
What is the InChIKey of 3,4-dibenzyl-3H-1,2,4-triazole-5-thione?
The InChIKey is SQFCQFMYNPXTPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3S/c20-16-18-17-15(11-13-7-3-1-4-8-13)19(16)12-14-9-5-2-6-10-14/h1-10,15H,11-12H2.
What are the key properties of 3,4-dibenzyl-3H-1,2,4-triazole-5-thione?
3,4-dibenzyl-3H-1,2,4-triazole-5-thione has a molecular weight of 281.38 g/mol, XLogP of 3.81, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibenzyl-3H-1,2,4-triazole-5-thione is sourced from PubChem (CID 24870433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).