C18H18N4O4 — CID 24870562
1,4-bis(3aH-benzimidazol-2-yl)butane-1,2,3,4-tetrol (PubChem CID 24870562) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is 1,4-bis(3aH-benzimidazol-2-yl)butane-1,2,3,4-tetrol.
| Compound Name | 1,4-bis(3aH-benzimidazol-2-yl)butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 24870562 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 1,4-bis(3aH-benzimidazol-2-yl)butane-1,2,3,4-tetrol |
| SMILES | OC(C1=NC2C=CC=CC2=N1)C(O)C(O)C(O)C1=NC2C=CC=CC2=N1 |
| InChI | InChI=1S/C18H18N4O4/c23-13(15(25)17-19-9-5-1-2-6-10(9)20-17)14(24)16(26)18-21-11-7-3-4-8-12(11)22-18/h1-9,11,13-16,23-26H |
| InChIKey | KFKRZERSASAQSA-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |