C20H24NO4+ — CID 24870847
16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2(10),4(8),15(20),16-pentaene (PubChem CID 24870847) has the molecular formula C20H24NO4+ and a molecular weight of 342.42 g/mol. Its IUPAC name is 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2(10),4(8),15(20),16-pentaene.
| Compound Name | 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2(10),4(8),15(20),16-pentaene |
|---|---|
| PubChem CID | 24870847 |
| Molecular Formula | C20H24NO4+ |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2(10),4(8),15(20),16-pentaene |
| SMILES | COC1=C(OC)C2=C(CC1)CC1=[N+](CCC3=C1CC1=C(C3)OCO1)C2 |
| InChI | InChI=1S/C20H24NO4/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2/h3-11H2,1-2H3/q+1 |
| InChIKey | SIIBRRANKPQCCK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 39.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|