C19H26N4O2 — CID 24871083
2,10,15,23-tetrazapentacyclo[12.9.0.02,11.04,9.017,22]tricosa-1(23),17(22)-diene-3,16-dione (PubChem CID 24871083) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 2,10,15,23-tetrazapentacyclo[12.9.0.02,11.04,9.017,22]tricosa-1(23),17(22)-diene-3,16-dione.
| Compound Name | 2,10,15,23-tetrazapentacyclo[12.9.0.02,11.04,9.017,22]tricosa-1(23),17(22)-diene-3,16-dione |
|---|---|
| PubChem CID | 24871083 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 2,10,15,23-tetrazapentacyclo[12.9.0.02,11.04,9.017,22]tricosa-1(23),17(22)-diene-3,16-dione |
| SMILES | O=C1NC2CCC3NC4CCCCC4C(=O)N3C2=NC2=C1CCCC2 |
| InChI | InChI=1S/C19H26N4O2/c24-18-11-5-1-3-7-13(11)21-17-15(22-18)9-10-16-20-14-8-4-2-6-12(14)19(25)23(16)17/h12,14-16,20H,1-10H2,(H,22,24) |
| InChIKey | XFRGNGVWHCFGNL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |