C12H16N4OS — CID 24871155
6-methyl-3-methylsulfanyl-6,7,8,9,10,11-hexahydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 24871155) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is 6-methyl-3-methylsulfanyl-6,7,8,9,10,11-hexahydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | 6-methyl-3-methylsulfanyl-6,7,8,9,10,11-hexahydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 24871155 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 6-methyl-3-methylsulfanyl-6,7,8,9,10,11-hexahydro-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | CSc1nnc2c(n1)OC(C)NC1=C2CCCC1 |
| InChI | InChI=1S/C12H16N4OS/c1-7-13-9-6-4-3-5-8(9)10-11(17-7)14-12(18-2)16-15-10/h7,13H,3-6H2,1-2H3 |
| InChIKey | GKWRQNWMDXSSOF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |