C12H20ClNO2 — CID 24871286
6,7-dimethoxy-1-methyl-1,2,3,4,5,8-hexahydroisoquinoline;hydrochloride (PubChem CID 24871286) has the molecular formula C12H20ClNO2 and a molecular weight of 245.75 g/mol. Its IUPAC name is 6,7-dimethoxy-1-methyl-1,2,3,4,5,8-hexahydroisoquinoline;hydrochloride.
| Compound Name | 6,7-dimethoxy-1-methyl-1,2,3,4,5,8-hexahydroisoquinoline;hydrochloride |
|---|---|
| PubChem CID | 24871286 |
| Molecular Formula | C12H20ClNO2 |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 6,7-dimethoxy-1-methyl-1,2,3,4,5,8-hexahydroisoquinoline;hydrochloride |
| SMILES | COC1=C(OC)CC2=C(CCNC2C)C1.Cl |
| InChI | InChI=1S/C12H19NO2.ClH/c1-8-10-7-12(15-3)11(14-2)6-9(10)4-5-13-8;/h8,13H,4-7H2,1-3H3;1H |
| InChIKey | ISCWPLMYKKUDEP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|