About (E)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine;hydrate;hydrochloride
(E)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine;hydrate;hydrochloride (PubChem CID 24871308) has the molecular formula C16H20BrClN2O
and a molecular weight of 371.71 g/mol. Its IUPAC name is (E)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine;hydrate;hydrochloride.
Molecular Properties
| Compound Name | (E)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine;hydrate;hydrochloride |
| PubChem CID | 24871308 |
| Molecular Formula | C16H20BrClN2O |
| Molecular Weight | 371.71 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | (E)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine;hydrate;hydrochloride |
| SMILES | CN(C)C/C=C(\c1ccc(Br)cc1)c1cccnc1.Cl.O |
| InChI | InChI=1S/C16H17BrN2.ClH.H2O/c1-19(2)11-9-16(14-4-3-10-18-12-14)13-5-7-15(17)8-6-13;;/h3-10,12H,11H2,1-2H3;1H;1H2/b16-9+;; |
| InChIKey | KXKQPDWRTMRFFX-NENXIMLWSA-N |
| XLogP | 3.43 |
| TPSA | 47.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.71 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine;hydrate;hydrochloride?
The IUPAC name of (E)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine;hydrate;hydrochloride (CID 24871308) is (E)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine;hydrate;hydrochloride.
What is the SMILES notation for (E)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine;hydrate;hydrochloride?
The canonical SMILES for (E)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine;hydrate;hydrochloride is CN(C)C/C=C(\c1ccc(Br)cc1)c1cccnc1.Cl.O.
What is the InChIKey of (E)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine;hydrate;hydrochloride?
The InChIKey is KXKQPDWRTMRFFX-NENXIMLWSA-N. The full InChI is InChI=1S/C16H17BrN2.ClH.H2O/c1-19(2)11-9-16(14-4-3-10-18-12-14)13-5-7-15(17)8-6-13;;/h3-10,12H,11H2,1-2H3;1H;1H2/b16-9+;;.
What are the key properties of (E)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine;hydrate;hydrochloride?
(E)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine;hydrate;hydrochloride has a molecular weight of 371.71 g/mol, XLogP of 3.43, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(4-bromophenyl)-N,N-dimethyl-3-pyridin-3-ylprop-2-en-1-amine;hydrate;hydrochloride is sourced from PubChem (CID 24871308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).