About (2R)-N,6-dimethylhept-5-en-2-amine
(2R)-N,6-dimethylhept-5-en-2-amine (PubChem CID 24871315) has the molecular formula C9H19N
and a molecular weight of 141.26 g/mol. Its IUPAC name is (2R)-N,6-dimethylhept-5-en-2-amine.
Molecular Properties
| Compound Name | (2R)-N,6-dimethylhept-5-en-2-amine |
| PubChem CID | 24871315 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | (2R)-N,6-dimethylhept-5-en-2-amine |
| SMILES | CN[C@H](C)CCC=C(C)C |
| InChI | InChI=1S/C9H19N/c1-8(2)6-5-7-9(3)10-4/h6,9-10H,5,7H2,1-4H3/t9-/m1/s1 |
| InChIKey | XVQUOJBERHHONY-SECBINFHSA-N |
| XLogP | 2.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N,6-dimethylhept-5-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N,6-dimethylhept-5-en-2-amine?
The IUPAC name of (2R)-N,6-dimethylhept-5-en-2-amine (CID 24871315) is (2R)-N,6-dimethylhept-5-en-2-amine.
What is the SMILES notation for (2R)-N,6-dimethylhept-5-en-2-amine?
The canonical SMILES for (2R)-N,6-dimethylhept-5-en-2-amine is CN[C@H](C)CCC=C(C)C.
What is the InChIKey of (2R)-N,6-dimethylhept-5-en-2-amine?
The InChIKey is XVQUOJBERHHONY-SECBINFHSA-N. The full InChI is InChI=1S/C9H19N/c1-8(2)6-5-7-9(3)10-4/h6,9-10H,5,7H2,1-4H3/t9-/m1/s1.
What are the key properties of (2R)-N,6-dimethylhept-5-en-2-amine?
(2R)-N,6-dimethylhept-5-en-2-amine has a molecular weight of 141.26 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N,6-dimethylhept-5-en-2-amine is sourced from PubChem (CID 24871315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).