C22H20O4 — CID 24871420
(9R)-9-(4-methoxyphenyl)-8,17-dioxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),11,13,15-tetraen-3-one (PubChem CID 24871420) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is (9R)-9-(4-methoxyphenyl)-8,17-dioxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),11,13,15-tetraen-3-one.
| Compound Name | (9R)-9-(4-methoxyphenyl)-8,17-dioxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),11,13,15-tetraen-3-one |
|---|---|
| PubChem CID | 24871420 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | (9R)-9-(4-methoxyphenyl)-8,17-dioxatetracyclo[7.7.1.02,7.011,16]heptadeca-2(7),11,13,15-tetraen-3-one |
| SMILES | COc1ccc([C@]23Cc4ccccc4C(O2)C2=C(CCCC2=O)O3)cc1 |
| InChI | InChI=1S/C22H20O4/c1-24-16-11-9-15(10-12-16)22-13-14-5-2-3-6-17(14)21(26-22)20-18(23)7-4-8-19(20)25-22/h2-3,5-6,9-12,21H,4,7-8,13H2,1H3/t21?,22-/m0/s1 |
| InChIKey | DLFUHCLEKOLYAQ-KEKNWZKVSA-N |
| XLogP | 4.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |