C9H16N2 — CID 24871662
1,2,4-triethylimidazole (PubChem CID 24871662) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 1,2,4-triethylimidazole.
| Compound Name | 1,2,4-triethylimidazole |
|---|---|
| PubChem CID | 24871662 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1,2,4-triethylimidazole |
| SMILES | CCc1cn(CC)c(CC)n1 |
| InChI | InChI=1S/C9H16N2/c1-4-8-7-11(6-3)9(5-2)10-8/h7H,4-6H2,1-3H3 |
| InChIKey | BRXVKUUWOLUKDM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |