C31H36N4O4S — CID 24871841
3-[[(2R)-17-ethyl-4-methyl-3,12-dioxo-7-propan-2-ylsulfanyl-13-oxa-4,11-diazatricyclo[14.2.2.16,10]henicosa-1(18),6,8,10(21),16,19-hexaen-2-yl]amino]benzamide (PubChem CID 24871841) has the molecular formula C31H36N4O4S and a molecular weight of 560.72 g/mol. Its IUPAC name is 3-[[(2R)-17-ethyl-4-methyl-3,12-dioxo-7-propan-2-ylsulfanyl-13-oxa-4,11-diazatricyclo[14.2.2.16,10]henicosa-1(18),6,8,10(21),16,19-hexaen-2-yl]amino]benzamide.
| Compound Name | 3-[[(2R)-17-ethyl-4-methyl-3,12-dioxo-7-propan-2-ylsulfanyl-13-oxa-4,11-diazatricyclo[14.2.2.16,10]henicosa-1(18),6,8,10(21),16,19-hexaen-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 24871841 |
| Molecular Formula | C31H36N4O4S |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | 3-[[(2R)-17-ethyl-4-methyl-3,12-dioxo-7-propan-2-ylsulfanyl-13-oxa-4,11-diazatricyclo[14.2.2.16,10]henicosa-1(18),6,8,10(21),16,19-hexaen-2-yl]amino]benzamide |
| SMILES | CCc1cc2ccc1CCOC(=O)Nc1ccc(SC(C)C)c(c1)CN(C)C(=O)[C@@H]2Nc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C31H36N4O4S/c1-5-20-15-22-10-9-21(20)13-14-39-31(38)34-26-11-12-27(40-19(2)3)24(17-26)18-35(4)30(37)28(22)33-25-8-6-7-23(16-25)29(32)36/h6-12,15-17,19,28,33H,5,13-14,18H2,1-4H3,(H2,32,36)(H,34,38)/t28-/m1/s1 |
| InChIKey | PZGSRGCSNBVVFG-MUUNZHRXSA-N |
| XLogP | 5.76 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |