C21H24O11 — CID 24871934
(2S)-2-(3,4-dihydroxyphenyl)-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-chromene-3,5,7-triol (PubChem CID 24871934) has the molecular formula C21H24O11 and a molecular weight of 452.41 g/mol. Its IUPAC name is (2S)-2-(3,4-dihydroxyphenyl)-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-chromene-3,5,7-triol.
| Compound Name | (2S)-2-(3,4-dihydroxyphenyl)-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
|---|---|
| PubChem CID | 24871934 |
| Molecular Formula | C21H24O11 |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | (2S)-2-(3,4-dihydroxyphenyl)-6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
| SMILES | OCC1OC(c2c(O)cc3c(c2O)CC(O)[C@H](c2ccc(O)c(O)c2)O3)C(O)C(O)C1O |
| InChI | InChI=1S/C21H24O11/c22-6-14-17(28)18(29)19(30)21(32-14)15-11(25)5-13-8(16(15)27)4-12(26)20(31-13)7-1-2-9(23)10(24)3-7/h1-3,5,12,14,17-30H,4,6H2/t12?,14?,17?,18?,19?,20-,21?/m0/s1 |
| InChIKey | PWMSPKVTJLJDDS-RBIKLOOPSA-N |
| XLogP | -0.94 |
| TPSA | 200.53 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|