About 2-(113C)methyl(1,2,3-13C3)propan-2-ol
2-(113C)methyl(1,2,3-13C3)propan-2-ol (PubChem CID 24872149) has the molecular formula C4H10O
and a molecular weight of 78.09 g/mol. Its IUPAC name is 2-(113C)methyl(1,2,3-13C3)propan-2-ol.
Molecular Properties
| Compound Name | 2-(113C)methyl(1,2,3-13C3)propan-2-ol |
| PubChem CID | 24872149 |
| Molecular Formula | C4H10O |
| Molecular Weight | 78.09 g/mol |
| Exact Mass | 78.09 |
| IUPAC Name | 2-(113C)methyl(1,2,3-13C3)propan-2-ol |
| SMILES | [13CH3][13C]([13CH3])([13CH3])O |
| InChI | InChI=1S/C4H10O/c1-4(2,3)5/h5H,1-3H3/i1+1,2+1,3+1,4+1 |
| InChIKey | DKGAVHZHDRPRBM-JCDJMFQYSA-N |
| XLogP | 0.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 78.09 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(113C)methyl(1,2,3-13C3)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(113C)methyl(1,2,3-13C3)propan-2-ol?
The IUPAC name of 2-(113C)methyl(1,2,3-13C3)propan-2-ol (CID 24872149) is 2-(113C)methyl(1,2,3-13C3)propan-2-ol.
What is the SMILES notation for 2-(113C)methyl(1,2,3-13C3)propan-2-ol?
The canonical SMILES for 2-(113C)methyl(1,2,3-13C3)propan-2-ol is [13CH3][13C]([13CH3])([13CH3])O.
What is the InChIKey of 2-(113C)methyl(1,2,3-13C3)propan-2-ol?
The InChIKey is DKGAVHZHDRPRBM-JCDJMFQYSA-N. The full InChI is InChI=1S/C4H10O/c1-4(2,3)5/h5H,1-3H3/i1+1,2+1,3+1,4+1.
What are the key properties of 2-(113C)methyl(1,2,3-13C3)propan-2-ol?
2-(113C)methyl(1,2,3-13C3)propan-2-ol has a molecular weight of 78.09 g/mol, XLogP of 0.78, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(113C)methyl(1,2,3-13C3)propan-2-ol is sourced from PubChem (CID 24872149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).