C32H37N5O3 — CID 24872189
3-[4-[4-[(1H-benzimidazol-2-ylamino)methyl]piperidin-1-yl]phenyl]-2-[(2,4,6-trimethylbenzoyl)amino]propanoic acid (PubChem CID 24872189) has the molecular formula C32H37N5O3 and a molecular weight of 539.68 g/mol. Its IUPAC name is 3-[4-[4-[(1H-benzimidazol-2-ylamino)methyl]piperidin-1-yl]phenyl]-2-[(2,4,6-trimethylbenzoyl)amino]propanoic acid.
| Compound Name | 3-[4-[4-[(1H-benzimidazol-2-ylamino)methyl]piperidin-1-yl]phenyl]-2-[(2,4,6-trimethylbenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 24872189 |
| Molecular Formula | C32H37N5O3 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | 3-[4-[4-[(1H-benzimidazol-2-ylamino)methyl]piperidin-1-yl]phenyl]-2-[(2,4,6-trimethylbenzoyl)amino]propanoic acid |
| SMILES | Cc1cc(C)c(C(=O)NC(Cc2ccc(N3CCC(CNc4nc5ccccc5[nH]4)CC3)cc2)C(=O)O)c(C)c1 |
| InChI | InChI=1S/C32H37N5O3/c1-20-16-21(2)29(22(3)17-20)30(38)34-28(31(39)40)18-23-8-10-25(11-9-23)37-14-12-24(13-15-37)19-33-32-35-26-6-4-5-7-27(26)36-32/h4-11,16-17,24,28H,12-15,18-19H2,1-3H3,(H,34,38)(H,39,40)(H2,33,35,36) |
| InChIKey | CJQBRSWCDQZXGS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|