C24H24F3N3O — CID 24872396
7-[4-[(2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl)oxy]phenyl]-2-(trifluoromethyl)quinazoline (PubChem CID 24872396) has the molecular formula C24H24F3N3O and a molecular weight of 427.47 g/mol. Its IUPAC name is 7-[4-[(2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl)oxy]phenyl]-2-(trifluoromethyl)quinazoline.
| Compound Name | 7-[4-[(2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl)oxy]phenyl]-2-(trifluoromethyl)quinazoline |
|---|---|
| PubChem CID | 24872396 |
| Molecular Formula | C24H24F3N3O |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 7-[4-[(2-methyl-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-yl)oxy]phenyl]-2-(trifluoromethyl)quinazoline |
| SMILES | CN1CC2CCCC(Oc3ccc(-c4ccc5cnc(C(F)(F)F)nc5c4)cc3)C2C1 |
| InChI | InChI=1S/C24H24F3N3O/c1-30-13-18-3-2-4-22(20(18)14-30)31-19-9-7-15(8-10-19)16-5-6-17-12-28-23(24(25,26)27)29-21(17)11-16/h5-12,18,20,22H,2-4,13-14H2,1H3 |
| InChIKey | PQXCSKAAFHALKR-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |