C27H29F3N2O4 — CID 24872650
3-[[4-[1-(2-butoxyquinolin-6-yl)-4,4,4-trifluorobutyl]benzoyl]amino]propanoic acid (PubChem CID 24872650) has the molecular formula C27H29F3N2O4 and a molecular weight of 502.53 g/mol. Its IUPAC name is 3-[[4-[1-(2-butoxyquinolin-6-yl)-4,4,4-trifluorobutyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[1-(2-butoxyquinolin-6-yl)-4,4,4-trifluorobutyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 24872650 |
| Molecular Formula | C27H29F3N2O4 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.21 |
| IUPAC Name | 3-[[4-[1-(2-butoxyquinolin-6-yl)-4,4,4-trifluorobutyl]benzoyl]amino]propanoic acid |
| SMILES | CCCCOc1ccc2cc(C(CCC(F)(F)F)c3ccc(C(=O)NCCC(=O)O)cc3)ccc2n1 |
| InChI | InChI=1S/C27H29F3N2O4/c1-2-3-16-36-24-11-9-21-17-20(8-10-23(21)32-24)22(12-14-27(28,29)30)18-4-6-19(7-5-18)26(35)31-15-13-25(33)34/h4-11,17,22H,2-3,12-16H2,1H3,(H,31,35)(H,33,34) |
| InChIKey | ZXFOGTLTZJITCA-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|