C22H36N2O3 — CID 24872684
N-[(1R,2R)-2-(diethylaminomethyl)cyclohexyl]-4-(2-ethoxyethoxy)benzamide (PubChem CID 24872684) has the molecular formula C22H36N2O3 and a molecular weight of 376.54 g/mol. Its IUPAC name is N-[(1R,2R)-2-(diethylaminomethyl)cyclohexyl]-4-(2-ethoxyethoxy)benzamide.
| Compound Name | N-[(1R,2R)-2-(diethylaminomethyl)cyclohexyl]-4-(2-ethoxyethoxy)benzamide |
|---|---|
| PubChem CID | 24872684 |
| Molecular Formula | C22H36N2O3 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.27 |
| IUPAC Name | N-[(1R,2R)-2-(diethylaminomethyl)cyclohexyl]-4-(2-ethoxyethoxy)benzamide |
| SMILES | CCOCCOc1ccc(C(=O)N[C@@H]2CCCC[C@@H]2CN(CC)CC)cc1 |
| InChI | InChI=1S/C22H36N2O3/c1-4-24(5-2)17-19-9-7-8-10-21(19)23-22(25)18-11-13-20(14-12-18)27-16-15-26-6-3/h11-14,19,21H,4-10,15-17H2,1-3H3,(H,23,25)/t19-,21-/m1/s1 |
| InChIKey | ZLJPPIYZCFRROG-TZIWHRDSSA-N |
| XLogP | 3.73 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|