C28H31FN4O3 — CID 24872878
2-[(2-ethyl-4-fluoro-6-methylbenzoyl)amino]-3-[4-[3-[(pyridin-2-ylamino)methyl]azetidin-1-yl]phenyl]propanoic acid (PubChem CID 24872878) has the molecular formula C28H31FN4O3 and a molecular weight of 490.58 g/mol. Its IUPAC name is 2-[(2-ethyl-4-fluoro-6-methylbenzoyl)amino]-3-[4-[3-[(pyridin-2-ylamino)methyl]azetidin-1-yl]phenyl]propanoic acid.
| Compound Name | 2-[(2-ethyl-4-fluoro-6-methylbenzoyl)amino]-3-[4-[3-[(pyridin-2-ylamino)methyl]azetidin-1-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 24872878 |
| Molecular Formula | C28H31FN4O3 |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 2-[(2-ethyl-4-fluoro-6-methylbenzoyl)amino]-3-[4-[3-[(pyridin-2-ylamino)methyl]azetidin-1-yl]phenyl]propanoic acid |
| SMILES | CCc1cc(F)cc(C)c1C(=O)NC(Cc1ccc(N2CC(CNc3ccccn3)C2)cc1)C(=O)O |
| InChI | InChI=1S/C28H31FN4O3/c1-3-21-14-22(29)12-18(2)26(21)27(34)32-24(28(35)36)13-19-7-9-23(10-8-19)33-16-20(17-33)15-31-25-6-4-5-11-30-25/h4-12,14,20,24H,3,13,15-17H2,1-2H3,(H,30,31)(H,32,34)(H,35,36) |
| InChIKey | QSFVTIVSPBJZEG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|