About 3,7-bis[(4-fluorophenyl)methyl]-9-hydroxy-5-methoxy-6H-pyrrolo[3,4-g]quinolin-8-one
3,7-bis[(4-fluorophenyl)methyl]-9-hydroxy-5-methoxy-6H-pyrrolo[3,4-g]quinolin-8-one (PubChem CID 24872913) has the molecular formula C26H20F2N2O3
and a molecular weight of 446.45 g/mol. Its IUPAC name is 3,7-bis[(4-fluorophenyl)methyl]-9-hydroxy-5-methoxy-6H-pyrrolo[3,4-g]quinolin-8-one.
Molecular Properties
| Compound Name | 3,7-bis[(4-fluorophenyl)methyl]-9-hydroxy-5-methoxy-6H-pyrrolo[3,4-g]quinolin-8-one |
| PubChem CID | 24872913 |
| Molecular Formula | C26H20F2N2O3 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 3,7-bis[(4-fluorophenyl)methyl]-9-hydroxy-5-methoxy-6H-pyrrolo[3,4-g]quinolin-8-one |
| SMILES | COc1c2c(c(O)c3ncc(Cc4ccc(F)cc4)cc13)C(=O)N(Cc1ccc(F)cc1)C2 |
| InChI | InChI=1S/C26H20F2N2O3/c1-33-25-20-11-17(10-15-2-6-18(27)7-3-15)12-29-23(20)24(31)22-21(25)14-30(26(22)32)13-16-4-8-19(28)9-5-16/h2-9,11-12,31H,10,13-14H2,1H3 |
| InChIKey | QMXPMYKXLRRXLH-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,7-bis[(4-fluorophenyl)methyl]-9-hydroxy-5-methoxy-6H-pyrrolo[3,4-g]quinolin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-bis[(4-fluorophenyl)methyl]-9-hydroxy-5-methoxy-6H-pyrrolo[3,4-g]quinolin-8-one?
The IUPAC name of 3,7-bis[(4-fluorophenyl)methyl]-9-hydroxy-5-methoxy-6H-pyrrolo[3,4-g]quinolin-8-one (CID 24872913) is 3,7-bis[(4-fluorophenyl)methyl]-9-hydroxy-5-methoxy-6H-pyrrolo[3,4-g]quinolin-8-one.
What is the SMILES notation for 3,7-bis[(4-fluorophenyl)methyl]-9-hydroxy-5-methoxy-6H-pyrrolo[3,4-g]quinolin-8-one?
The canonical SMILES for 3,7-bis[(4-fluorophenyl)methyl]-9-hydroxy-5-methoxy-6H-pyrrolo[3,4-g]quinolin-8-one is COc1c2c(c(O)c3ncc(Cc4ccc(F)cc4)cc13)C(=O)N(Cc1ccc(F)cc1)C2.
What is the InChIKey of 3,7-bis[(4-fluorophenyl)methyl]-9-hydroxy-5-methoxy-6H-pyrrolo[3,4-g]quinolin-8-one?
The InChIKey is QMXPMYKXLRRXLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20F2N2O3/c1-33-25-20-11-17(10-15-2-6-18(27)7-3-15)12-29-23(20)24(31)22-21(25)14-30(26(22)32)13-16-4-8-19(28)9-5-16/h2-9,11-12,31H,10,13-14H2,1H3.
What are the key properties of 3,7-bis[(4-fluorophenyl)methyl]-9-hydroxy-5-methoxy-6H-pyrrolo[3,4-g]quinolin-8-one?
3,7-bis[(4-fluorophenyl)methyl]-9-hydroxy-5-methoxy-6H-pyrrolo[3,4-g]quinolin-8-one has a molecular weight of 446.45 g/mol, XLogP of 4.97, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-bis[(4-fluorophenyl)methyl]-9-hydroxy-5-methoxy-6H-pyrrolo[3,4-g]quinolin-8-one is sourced from PubChem (CID 24872913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).