About butan-2-ylazanium chloride
butan-2-ylazanium chloride (PubChem CID 24873) has the molecular formula C4H12ClN
and a molecular weight of 109.60 g/mol. Its IUPAC name is butan-2-ylazanium chloride.
Molecular Properties
| Compound Name | butan-2-ylazanium chloride |
| PubChem CID | 24873 |
| Molecular Formula | C4H12ClN |
| Molecular Weight | 109.60 g/mol |
| Exact Mass | 109.07 |
| IUPAC Name | butan-2-ylazanium chloride |
| SMILES | CCC(C)[NH3+].[Cl-] |
| InChI | InChI=1S/C4H11N.ClH/c1-3-4(2)5;/h4H,3,5H2,1-2H3;1H |
| InChIKey | VBPUICBFVUTJSE-UHFFFAOYSA-N |
| XLogP | -2.97 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.60 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze butan-2-ylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-ylazanium chloride?
The IUPAC name of butan-2-ylazanium chloride (CID 24873) is butan-2-ylazanium chloride.
What is the SMILES notation for butan-2-ylazanium chloride?
The canonical SMILES for butan-2-ylazanium chloride is CCC(C)[NH3+].[Cl-].
What is the InChIKey of butan-2-ylazanium chloride?
The InChIKey is VBPUICBFVUTJSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N.ClH/c1-3-4(2)5;/h4H,3,5H2,1-2H3;1H.
What are the key properties of butan-2-ylazanium chloride?
butan-2-ylazanium chloride has a molecular weight of 109.60 g/mol, XLogP of -2.97, 1 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-ylazanium chloride is sourced from PubChem (CID 24873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).