C15H18N4O7S — CID 24873072
[(2S,5R)-2-[(2-amino-2-oxo-1-phenylethyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate (PubChem CID 24873072) has the molecular formula C15H18N4O7S and a molecular weight of 398.40 g/mol. Its IUPAC name is [(2S,5R)-2-[(2-amino-2-oxo-1-phenylethyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate.
| Compound Name | [(2S,5R)-2-[(2-amino-2-oxo-1-phenylethyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 24873072 |
| Molecular Formula | C15H18N4O7S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | [(2S,5R)-2-[(2-amino-2-oxo-1-phenylethyl)carbamoyl]-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] hydrogen sulfate |
| SMILES | NC(=O)C(NC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O)c1ccccc1 |
| InChI | InChI=1S/C15H18N4O7S/c16-13(20)12(9-4-2-1-3-5-9)17-14(21)11-7-6-10-8-18(11)15(22)19(10)26-27(23,24)25/h1-5,10-12H,6-8H2,(H2,16,20)(H,17,21)(H,23,24,25)/t10-,11+,12?/m1/s1 |
| InChIKey | JKMBHUXTLQNNTI-UBNQGINQSA-N |
| XLogP | -0.67 |
| TPSA | 159.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|