C20H20ClN3O — CID 24873256
2-[[3-(4-chlorophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-d]azepin-2-yl]methyl]phenol (PubChem CID 24873256) has the molecular formula C20H20ClN3O and a molecular weight of 353.85 g/mol. Its IUPAC name is 2-[[3-(4-chlorophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-d]azepin-2-yl]methyl]phenol.
| Compound Name | 2-[[3-(4-chlorophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-d]azepin-2-yl]methyl]phenol |
|---|---|
| PubChem CID | 24873256 |
| Molecular Formula | C20H20ClN3O |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 2-[[3-(4-chlorophenyl)-5,6,7,8-tetrahydro-4H-pyrazolo[3,4-d]azepin-2-yl]methyl]phenol |
| SMILES | Oc1ccccc1Cn1nc2c(c1-c1ccc(Cl)cc1)CCNCC2 |
| InChI | InChI=1S/C20H20ClN3O/c21-16-7-5-14(6-8-16)20-17-9-11-22-12-10-18(17)23-24(20)13-15-3-1-2-4-19(15)25/h1-8,22,25H,9-13H2 |
| InChIKey | CEKUJRIIYNSZLU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|