C22H31N3O4 — CID 24873465
3-[[1-(4-aminobutyl)-4-methyl-6-oxo-2-phenyl-2,3-dihydropyridin-5-yl]-propylamino]-3-oxopropanoic acid (PubChem CID 24873465) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is 3-[[1-(4-aminobutyl)-4-methyl-6-oxo-2-phenyl-2,3-dihydropyridin-5-yl]-propylamino]-3-oxopropanoic acid.
| Compound Name | 3-[[1-(4-aminobutyl)-4-methyl-6-oxo-2-phenyl-2,3-dihydropyridin-5-yl]-propylamino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 24873465 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 3-[[1-(4-aminobutyl)-4-methyl-6-oxo-2-phenyl-2,3-dihydropyridin-5-yl]-propylamino]-3-oxopropanoic acid |
| SMILES | CCCN(C(=O)CC(=O)O)C1=C(C)CC(c2ccccc2)N(CCCCN)C1=O |
| InChI | InChI=1S/C22H31N3O4/c1-3-12-25(19(26)15-20(27)28)21-16(2)14-18(17-9-5-4-6-10-17)24(22(21)29)13-8-7-11-23/h4-6,9-10,18H,3,7-8,11-15,23H2,1-2H3,(H,27,28) |
| InChIKey | LFJKKQPLVRUFPC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|