C21H27NO3 — CID 24873614
methyl (2E)-2-[(3R,7aS,8R,11aS)-8-methyl-3-phenyl-3,6,7,7a,8,9,10,11-octahydro-2H-[1,3]oxazolo[2,3-j]quinolin-5-ylidene]acetate (PubChem CID 24873614) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is methyl (2E)-2-[(3R,7aS,8R,11aS)-8-methyl-3-phenyl-3,6,7,7a,8,9,10,11-octahydro-2H-[1,3]oxazolo[2,3-j]quinolin-5-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(3R,7aS,8R,11aS)-8-methyl-3-phenyl-3,6,7,7a,8,9,10,11-octahydro-2H-[1,3]oxazolo[2,3-j]quinolin-5-ylidene]acetate |
|---|---|
| PubChem CID | 24873614 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | methyl (2E)-2-[(3R,7aS,8R,11aS)-8-methyl-3-phenyl-3,6,7,7a,8,9,10,11-octahydro-2H-[1,3]oxazolo[2,3-j]quinolin-5-ylidene]acetate |
| SMILES | COC(=O)/C=C1\CC[C@H]2[C@H](C)CCC[C@]23OC[C@@H](c2ccccc2)N13 |
| InChI | InChI=1S/C21H27NO3/c1-15-7-6-12-21-18(15)11-10-17(13-20(23)24-2)22(21)19(14-25-21)16-8-4-3-5-9-16/h3-5,8-9,13,15,18-19H,6-7,10-12,14H2,1-2H3/b17-13+/t15-,18+,19+,21+/m1/s1 |
| InChIKey | DBVRPCMOWGOVNY-GATMVNPVSA-N |
| XLogP | 4.04 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|