C32H46O6Si2 — CID 24873833
methyl (2R,4R,5R,6E,8R)-7-[tert-butyl(dimethyl)silyl]oxy-5-[dimethyl(phenyl)silyl]-4-formyl-2-(phenylmethoxymethyl)-3,4,5,8-tetrahydro-2H-oxocine-8-carboxylate (PubChem CID 24873833) has the molecular formula C32H46O6Si2 and a molecular weight of 582.89 g/mol. Its IUPAC name is methyl (2R,4R,5R,6E,8R)-7-[tert-butyl(dimethyl)silyl]oxy-5-[dimethyl(phenyl)silyl]-4-formyl-2-(phenylmethoxymethyl)-3,4,5,8-tetrahydro-2H-oxocine-8-carboxylate.
| Compound Name | methyl (2R,4R,5R,6E,8R)-7-[tert-butyl(dimethyl)silyl]oxy-5-[dimethyl(phenyl)silyl]-4-formyl-2-(phenylmethoxymethyl)-3,4,5,8-tetrahydro-2H-oxocine-8-carboxylate |
|---|---|
| PubChem CID | 24873833 |
| Molecular Formula | C32H46O6Si2 |
| Molecular Weight | 582.89 g/mol |
| Exact Mass | 582.28 |
| IUPAC Name | methyl (2R,4R,5R,6E,8R)-7-[tert-butyl(dimethyl)silyl]oxy-5-[dimethyl(phenyl)silyl]-4-formyl-2-(phenylmethoxymethyl)-3,4,5,8-tetrahydro-2H-oxocine-8-carboxylate |
| SMILES | COC(=O)[C@@H]1O[C@@H](COCc2ccccc2)C[C@H](C=O)[C@H]([Si](C)(C)c2ccccc2)/C=C\1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H46O6Si2/c1-32(2,3)40(7,8)38-28-20-29(39(5,6)27-17-13-10-14-18-27)25(21-33)19-26(37-30(28)31(34)35-4)23-36-22-24-15-11-9-12-16-24/h9-18,20-21,25-26,29-30H,19,22-23H2,1-8H3/b28-20+/t25-,26-,29-,30-/m1/s1 |
| InChIKey | WOWKUORVISJWNN-PPRSPUAGSA-N |
| XLogP | 6.24 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.89 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|