C28H34O5 — CID 24873899
ethyl (2E,4E,6S)-2-methyl-6-phenylmethoxy-6-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]hexa-2,4-dienoate (PubChem CID 24873899) has the molecular formula C28H34O5 and a molecular weight of 450.58 g/mol. Its IUPAC name is ethyl (2E,4E,6S)-2-methyl-6-phenylmethoxy-6-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]hexa-2,4-dienoate.
| Compound Name | ethyl (2E,4E,6S)-2-methyl-6-phenylmethoxy-6-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]hexa-2,4-dienoate |
|---|---|
| PubChem CID | 24873899 |
| Molecular Formula | C28H34O5 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | ethyl (2E,4E,6S)-2-methyl-6-phenylmethoxy-6-[(2R,5R)-5-(phenylmethoxymethyl)oxolan-2-yl]hexa-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C/C=C/[C@H](OCc1ccccc1)[C@H]1CC[C@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C28H34O5/c1-3-31-28(29)22(2)11-10-16-26(32-20-24-14-8-5-9-15-24)27-18-17-25(33-27)21-30-19-23-12-6-4-7-13-23/h4-16,25-27H,3,17-21H2,1-2H3/b16-10+,22-11+/t25-,26+,27-/m1/s1 |
| InChIKey | YZPLAJZNCJTRCN-MJQVCVISSA-N |
| XLogP | 5.40 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|