C16H8Cl4N4S — CID 24874046
6-(4-chlorophenyl)-3-(2,3,5-trichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 24874046) has the molecular formula C16H8Cl4N4S and a molecular weight of 430.15 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-(2,3,5-trichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 6-(4-chlorophenyl)-3-(2,3,5-trichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 24874046 |
| Molecular Formula | C16H8Cl4N4S |
| Molecular Weight | 430.15 g/mol |
| Exact Mass | 427.92 |
| IUPAC Name | 6-(4-chlorophenyl)-3-(2,3,5-trichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | Clc1ccc(C2=Nn3c(nnc3-c3cc(Cl)cc(Cl)c3Cl)SC2)cc1 |
| InChI | InChI=1S/C16H8Cl4N4S/c17-9-3-1-8(2-4-9)13-7-25-16-22-21-15(24(16)23-13)11-5-10(18)6-12(19)14(11)20/h1-6H,7H2 |
| InChIKey | JIZBGZCJZLYXDK-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.15 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|