C12H15N5 — CID 24874175
N,2-dimethyl-8-pent-1-ynylpyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 24874175) has the molecular formula C12H15N5 and a molecular weight of 229.29 g/mol. Its IUPAC name is N,2-dimethyl-8-pent-1-ynylpyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | N,2-dimethyl-8-pent-1-ynylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 24874175 |
| Molecular Formula | C12H15N5 |
| Molecular Weight | 229.29 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N,2-dimethyl-8-pent-1-ynylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | CCCC#Cc1cnn2c(NC)nc(C)nc12 |
| InChI | InChI=1S/C12H15N5/c1-4-5-6-7-10-8-14-17-11(10)15-9(2)16-12(17)13-3/h8H,4-5H2,1-3H3,(H,13,15,16) |
| InChIKey | IVVXTTHGOJADBJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.29 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|