C29H21ClOS — CID 24874205
(1R,8S,9S,10S,11S)-9-chloro-1,8-diphenyl-10-phenylsulfanyl-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene (PubChem CID 24874205) has the molecular formula C29H21ClOS and a molecular weight of 453.01 g/mol. Its IUPAC name is (1R,8S,9S,10S,11S)-9-chloro-1,8-diphenyl-10-phenylsulfanyl-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene.
| Compound Name | (1R,8S,9S,10S,11S)-9-chloro-1,8-diphenyl-10-phenylsulfanyl-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene |
|---|---|
| PubChem CID | 24874205 |
| Molecular Formula | C29H21ClOS |
| Molecular Weight | 453.01 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | (1R,8S,9S,10S,11S)-9-chloro-1,8-diphenyl-10-phenylsulfanyl-12-oxatetracyclo[6.3.1.02,7.09,11]dodeca-2,4,6-triene |
| SMILES | Cl[C@]12[C@H]([C@@H]1Sc1ccccc1)[C@]1(c3ccccc3)O[C@@]2(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C29H21ClOS/c30-28-25(26(28)32-22-16-8-3-9-17-22)27(20-12-4-1-5-13-20)23-18-10-11-19-24(23)29(28,31-27)21-14-6-2-7-15-21/h1-19,25-26H/t25-,26+,27-,28-,29+/m1/s1 |
| InChIKey | UIIPMFCOKILIAA-FOECPVOOSA-N |
| XLogP | 6.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.01 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|