About 5-(benzenesulfonyl)-3-(2,6-dichlorophenyl)-1,2-oxazole
5-(benzenesulfonyl)-3-(2,6-dichlorophenyl)-1,2-oxazole (PubChem CID 24874346) has the molecular formula C15H9Cl2NO3S
and a molecular weight of 354.21 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-3-(2,6-dichlorophenyl)-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(benzenesulfonyl)-3-(2,6-dichlorophenyl)-1,2-oxazole |
| PubChem CID | 24874346 |
| Molecular Formula | C15H9Cl2NO3S |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | 5-(benzenesulfonyl)-3-(2,6-dichlorophenyl)-1,2-oxazole |
| SMILES | O=S(=O)(c1ccccc1)c1cc(-c2c(Cl)cccc2Cl)no1 |
| InChI | InChI=1S/C15H9Cl2NO3S/c16-11-7-4-8-12(17)15(11)13-9-14(21-18-13)22(19,20)10-5-2-1-3-6-10/h1-9H |
| InChIKey | NROVDRJQDVFOMY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(benzenesulfonyl)-3-(2,6-dichlorophenyl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(benzenesulfonyl)-3-(2,6-dichlorophenyl)-1,2-oxazole?
The IUPAC name of 5-(benzenesulfonyl)-3-(2,6-dichlorophenyl)-1,2-oxazole (CID 24874346) is 5-(benzenesulfonyl)-3-(2,6-dichlorophenyl)-1,2-oxazole.
What is the SMILES notation for 5-(benzenesulfonyl)-3-(2,6-dichlorophenyl)-1,2-oxazole?
The canonical SMILES for 5-(benzenesulfonyl)-3-(2,6-dichlorophenyl)-1,2-oxazole is O=S(=O)(c1ccccc1)c1cc(-c2c(Cl)cccc2Cl)no1.
What is the InChIKey of 5-(benzenesulfonyl)-3-(2,6-dichlorophenyl)-1,2-oxazole?
The InChIKey is NROVDRJQDVFOMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9Cl2NO3S/c16-11-7-4-8-12(17)15(11)13-9-14(21-18-13)22(19,20)10-5-2-1-3-6-10/h1-9H.
What are the key properties of 5-(benzenesulfonyl)-3-(2,6-dichlorophenyl)-1,2-oxazole?
5-(benzenesulfonyl)-3-(2,6-dichlorophenyl)-1,2-oxazole has a molecular weight of 354.21 g/mol, XLogP of 4.48, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(benzenesulfonyl)-3-(2,6-dichlorophenyl)-1,2-oxazole is sourced from PubChem (CID 24874346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).