About 2-[4-(1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane
2-[4-(1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane (PubChem CID 24874395) has the molecular formula C11H13BO4
and a molecular weight of 220.03 g/mol. Its IUPAC name is 2-[4-(1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane.
Molecular Properties
| Compound Name | 2-[4-(1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane |
| PubChem CID | 24874395 |
| Molecular Formula | C11H13BO4 |
| Molecular Weight | 220.03 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 2-[4-(1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane |
| SMILES | c1cc(C2OCCO2)ccc1B1OCCO1 |
| InChI | InChI=1S/C11H13BO4/c1-3-10(12-15-7-8-16-12)4-2-9(1)11-13-5-6-14-11/h1-4,11H,5-8H2 |
| InChIKey | JKEZKYGQVUNIGD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.03 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane?
The IUPAC name of 2-[4-(1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane (CID 24874395) is 2-[4-(1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane.
What is the SMILES notation for 2-[4-(1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane?
The canonical SMILES for 2-[4-(1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane is c1cc(C2OCCO2)ccc1B1OCCO1.
What is the InChIKey of 2-[4-(1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane?
The InChIKey is JKEZKYGQVUNIGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BO4/c1-3-10(12-15-7-8-16-12)4-2-9(1)11-13-5-6-14-11/h1-4,11H,5-8H2.
What are the key properties of 2-[4-(1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane?
2-[4-(1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane has a molecular weight of 220.03 g/mol, XLogP of 0.47, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,3-dioxolan-2-yl)phenyl]-1,3,2-dioxaborolane is sourced from PubChem (CID 24874395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).