C18H32O5 — CID 24874526
[(4S,6S,8S)-6-methoxy-8-methyl-10-oxodecan-4-yl] (3R)-3-hydroxyhex-5-enoate (PubChem CID 24874526) has the molecular formula C18H32O5 and a molecular weight of 328.45 g/mol. Its IUPAC name is [(4S,6S,8S)-6-methoxy-8-methyl-10-oxodecan-4-yl] (3R)-3-hydroxyhex-5-enoate.
| Compound Name | [(4S,6S,8S)-6-methoxy-8-methyl-10-oxodecan-4-yl] (3R)-3-hydroxyhex-5-enoate |
|---|---|
| PubChem CID | 24874526 |
| Molecular Formula | C18H32O5 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | [(4S,6S,8S)-6-methoxy-8-methyl-10-oxodecan-4-yl] (3R)-3-hydroxyhex-5-enoate |
| SMILES | C=CC[C@@H](O)CC(=O)O[C@@H](CCC)C[C@H](C[C@H](C)CC=O)OC |
| InChI | InChI=1S/C18H32O5/c1-5-7-15(20)12-18(21)23-16(8-6-2)13-17(22-4)11-14(3)9-10-19/h5,10,14-17,20H,1,6-9,11-13H2,2-4H3/t14-,15-,16+,17+/m1/s1 |
| InChIKey | FEWIDPQFBHCMFZ-NCOADZHNSA-N |
| XLogP | 3.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|