C29H35NO — CID 24874572
(2R,4S)-4-benzhydryloxy-1-(2-phenylethyl)-2-propan-2-ylpiperidine (PubChem CID 24874572) has the molecular formula C29H35NO and a molecular weight of 413.61 g/mol. Its IUPAC name is (2R,4S)-4-benzhydryloxy-1-(2-phenylethyl)-2-propan-2-ylpiperidine.
| Compound Name | (2R,4S)-4-benzhydryloxy-1-(2-phenylethyl)-2-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 24874572 |
| Molecular Formula | C29H35NO |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.27 |
| IUPAC Name | (2R,4S)-4-benzhydryloxy-1-(2-phenylethyl)-2-propan-2-ylpiperidine |
| SMILES | CC(C)[C@H]1C[C@@H](OC(c2ccccc2)c2ccccc2)CCN1CCc1ccccc1 |
| InChI | InChI=1S/C29H35NO/c1-23(2)28-22-27(19-21-30(28)20-18-24-12-6-3-7-13-24)31-29(25-14-8-4-9-15-25)26-16-10-5-11-17-26/h3-17,23,27-29H,18-22H2,1-2H3/t27-,28+/m0/s1 |
| InChIKey | QZHRCCSPVWFUAC-WUFINQPMSA-N |
| XLogP | 6.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |