C31H29N9O3S — CID 24874925
1-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[(2R)-2-methyl-4-(2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 24874925) has the molecular formula C31H29N9O3S and a molecular weight of 607.70 g/mol. Its IUPAC name is 1-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[(2R)-2-methyl-4-(2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[(2R)-2-methyl-4-(2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 24874925 |
| Molecular Formula | C31H29N9O3S |
| Molecular Weight | 607.70 g/mol |
| Exact Mass | 607.21 |
| IUPAC Name | 1-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[(2R)-2-methyl-4-(2-methyl-5-phenylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | COc1cnc(-n2cnc(C)n2)c2[nH]cc(C(=O)C(=O)N3CCN(c4nc(C)nc5scc(-c6ccccc6)c45)C[C@H]3C)c12 |
| InChI | InChI=1S/C31H29N9O3S/c1-17-14-38(28-25-22(20-8-6-5-7-9-20)15-44-30(25)36-19(3)35-28)10-11-39(17)31(42)27(41)21-12-32-26-24(21)23(43-4)13-33-29(26)40-16-34-18(2)37-40/h5-9,12-13,15-17,32H,10-11,14H2,1-4H3/t17-/m1/s1 |
| InChIKey | NUSQSVKAZQYTND-QGZVFWFLSA-N |
| XLogP | 4.36 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.70 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|