C30H27N9O3S — CID 24874966
1-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[(2R)-2-methyl-4-(6-phenylthieno[3,2-d]pyrimidin-4-yl)piperazin-1-yl]ethane-1,2-dione (PubChem CID 24874966) has the molecular formula C30H27N9O3S and a molecular weight of 593.67 g/mol. Its IUPAC name is 1-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[(2R)-2-methyl-4-(6-phenylthieno[3,2-d]pyrimidin-4-yl)piperazin-1-yl]ethane-1,2-dione.
| Compound Name | 1-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[(2R)-2-methyl-4-(6-phenylthieno[3,2-d]pyrimidin-4-yl)piperazin-1-yl]ethane-1,2-dione |
|---|---|
| PubChem CID | 24874966 |
| Molecular Formula | C30H27N9O3S |
| Molecular Weight | 593.67 g/mol |
| Exact Mass | 593.20 |
| IUPAC Name | 1-[4-methoxy-7-(3-methyl-1,2,4-triazol-1-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-[(2R)-2-methyl-4-(6-phenylthieno[3,2-d]pyrimidin-4-yl)piperazin-1-yl]ethane-1,2-dione |
| SMILES | COc1cnc(-n2cnc(C)n2)c2[nH]cc(C(=O)C(=O)N3CCN(c4ncnc5cc(-c6ccccc6)sc45)C[C@H]3C)c12 |
| InChI | InChI=1S/C30H27N9O3S/c1-17-14-37(29-27-21(33-15-34-29)11-23(43-27)19-7-5-4-6-8-19)9-10-38(17)30(41)26(40)20-12-31-25-24(20)22(42-3)13-32-28(25)39-16-35-18(2)36-39/h4-8,11-13,15-17,31H,9-10,14H2,1-3H3/t17-/m1/s1 |
| InChIKey | UVVNGBXGZRMRTO-QGZVFWFLSA-N |
| XLogP | 4.05 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|