C29H44N4O3 — CID 24875443
(3S,5R)-5-N-cyclopropyl-3-N-(2-ethylbutyl)-5-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3,5-dicarboxamide (PubChem CID 24875443) has the molecular formula C29H44N4O3 and a molecular weight of 496.70 g/mol. Its IUPAC name is (3S,5R)-5-N-cyclopropyl-3-N-(2-ethylbutyl)-5-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3,5-dicarboxamide.
| Compound Name | (3S,5R)-5-N-cyclopropyl-3-N-(2-ethylbutyl)-5-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 24875443 |
| Molecular Formula | C29H44N4O3 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | (3S,5R)-5-N-cyclopropyl-3-N-(2-ethylbutyl)-5-N-[[1-(3-methoxypropyl)indol-3-yl]methyl]piperidine-3,5-dicarboxamide |
| SMILES | CCC(CC)CNC(=O)[C@@H]1CNC[C@H](C(=O)N(Cc2cn(CCCOC)c3ccccc23)C2CC2)C1 |
| InChI | InChI=1S/C29H44N4O3/c1-4-21(5-2)16-31-28(34)22-15-23(18-30-17-22)29(35)33(25-11-12-25)20-24-19-32(13-8-14-36-3)27-10-7-6-9-26(24)27/h6-7,9-10,19,21-23,25,30H,4-5,8,11-18,20H2,1-3H3,(H,31,34)/t22-,23+/m0/s1 |
| InChIKey | ZOUZQQJYEKPRPG-XZOQPEGZSA-N |
| XLogP | 3.95 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|