About 4-(4-chlorophenyl)sulfonyl-5,8-difluoro-4-methyl-2,3-dihydrochromene
4-(4-chlorophenyl)sulfonyl-5,8-difluoro-4-methyl-2,3-dihydrochromene (PubChem CID 24875617) has the molecular formula C16H13ClF2O3S
and a molecular weight of 358.79 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfonyl-5,8-difluoro-4-methyl-2,3-dihydrochromene.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)sulfonyl-5,8-difluoro-4-methyl-2,3-dihydrochromene |
| PubChem CID | 24875617 |
| Molecular Formula | C16H13ClF2O3S |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 4-(4-chlorophenyl)sulfonyl-5,8-difluoro-4-methyl-2,3-dihydrochromene |
| SMILES | CC1(S(=O)(=O)c2ccc(Cl)cc2)CCOc2c(F)ccc(F)c21 |
| InChI | InChI=1S/C16H13ClF2O3S/c1-16(23(20,21)11-4-2-10(17)3-5-11)8-9-22-15-13(19)7-6-12(18)14(15)16/h2-7H,8-9H2,1H3 |
| InChIKey | UDAOAODUTRFIQO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-chlorophenyl)sulfonyl-5,8-difluoro-4-methyl-2,3-dihydrochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)sulfonyl-5,8-difluoro-4-methyl-2,3-dihydrochromene?
The IUPAC name of 4-(4-chlorophenyl)sulfonyl-5,8-difluoro-4-methyl-2,3-dihydrochromene (CID 24875617) is 4-(4-chlorophenyl)sulfonyl-5,8-difluoro-4-methyl-2,3-dihydrochromene.
What is the SMILES notation for 4-(4-chlorophenyl)sulfonyl-5,8-difluoro-4-methyl-2,3-dihydrochromene?
The canonical SMILES for 4-(4-chlorophenyl)sulfonyl-5,8-difluoro-4-methyl-2,3-dihydrochromene is CC1(S(=O)(=O)c2ccc(Cl)cc2)CCOc2c(F)ccc(F)c21.
What is the InChIKey of 4-(4-chlorophenyl)sulfonyl-5,8-difluoro-4-methyl-2,3-dihydrochromene?
The InChIKey is UDAOAODUTRFIQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClF2O3S/c1-16(23(20,21)11-4-2-10(17)3-5-11)8-9-22-15-13(19)7-6-12(18)14(15)16/h2-7H,8-9H2,1H3.
What are the key properties of 4-(4-chlorophenyl)sulfonyl-5,8-difluoro-4-methyl-2,3-dihydrochromene?
4-(4-chlorophenyl)sulfonyl-5,8-difluoro-4-methyl-2,3-dihydrochromene has a molecular weight of 358.79 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)sulfonyl-5,8-difluoro-4-methyl-2,3-dihydrochromene is sourced from PubChem (CID 24875617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).