C28H22Cl2F2N4O3 — CID 24875890
(3R,5'S,7'S)-6-chloro-7'-(3-chlorophenyl)-5'-(2,3-difluoro-6-propan-2-yloxyphenyl)spiro[1H-indole-3,6'-2,5,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine]-2,3'-dione (PubChem CID 24875890) has the molecular formula C28H22Cl2F2N4O3 and a molecular weight of 571.41 g/mol. Its IUPAC name is (3R,5'S,7'S)-6-chloro-7'-(3-chlorophenyl)-5'-(2,3-difluoro-6-propan-2-yloxyphenyl)spiro[1H-indole-3,6'-2,5,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine]-2,3'-dione.
| Compound Name | (3R,5'S,7'S)-6-chloro-7'-(3-chlorophenyl)-5'-(2,3-difluoro-6-propan-2-yloxyphenyl)spiro[1H-indole-3,6'-2,5,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine]-2,3'-dione |
|---|---|
| PubChem CID | 24875890 |
| Molecular Formula | C28H22Cl2F2N4O3 |
| Molecular Weight | 571.41 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | (3R,5'S,7'S)-6-chloro-7'-(3-chlorophenyl)-5'-(2,3-difluoro-6-propan-2-yloxyphenyl)spiro[1H-indole-3,6'-2,5,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine]-2,3'-dione |
| SMILES | CC(C)Oc1ccc(F)c(F)c1[C@H]1n2c(n[nH]c2=O)C[C@@H](c2cccc(Cl)c2)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C28H22Cl2F2N4O3/c1-13(2)39-21-9-8-19(31)24(32)23(21)25-28(17-7-6-16(30)11-20(17)33-26(28)37)18(14-4-3-5-15(29)10-14)12-22-34-35-27(38)36(22)25/h3-11,13,18,25H,12H2,1-2H3,(H,33,37)(H,35,38)/t18-,25+,28-/m0/s1 |
| InChIKey | BCHXLWNWBWNSLN-IRTCRQIFSA-N |
| XLogP | 5.76 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.41 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |