About 1-(4-chlorophenyl)sulfonyl-4,7-difluoro-3-methyl-2,3-dihydro-1H-indene
1-(4-chlorophenyl)sulfonyl-4,7-difluoro-3-methyl-2,3-dihydro-1H-indene (PubChem CID 24875987) has the molecular formula C16H13ClF2O2S
and a molecular weight of 342.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-4,7-difluoro-3-methyl-2,3-dihydro-1H-indene.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)sulfonyl-4,7-difluoro-3-methyl-2,3-dihydro-1H-indene |
| PubChem CID | 24875987 |
| Molecular Formula | C16H13ClF2O2S |
| Molecular Weight | 342.79 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-4,7-difluoro-3-methyl-2,3-dihydro-1H-indene |
| SMILES | CC1CC(S(=O)(=O)c2ccc(Cl)cc2)c2c(F)ccc(F)c21 |
| InChI | InChI=1S/C16H13ClF2O2S/c1-9-8-14(16-13(19)7-6-12(18)15(9)16)22(20,21)11-4-2-10(17)3-5-11/h2-7,9,14H,8H2,1H3 |
| InChIKey | BQLDQNLXKDPKAM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.79 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-chlorophenyl)sulfonyl-4,7-difluoro-3-methyl-2,3-dihydro-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)sulfonyl-4,7-difluoro-3-methyl-2,3-dihydro-1H-indene?
The IUPAC name of 1-(4-chlorophenyl)sulfonyl-4,7-difluoro-3-methyl-2,3-dihydro-1H-indene (CID 24875987) is 1-(4-chlorophenyl)sulfonyl-4,7-difluoro-3-methyl-2,3-dihydro-1H-indene.
What is the SMILES notation for 1-(4-chlorophenyl)sulfonyl-4,7-difluoro-3-methyl-2,3-dihydro-1H-indene?
The canonical SMILES for 1-(4-chlorophenyl)sulfonyl-4,7-difluoro-3-methyl-2,3-dihydro-1H-indene is CC1CC(S(=O)(=O)c2ccc(Cl)cc2)c2c(F)ccc(F)c21.
What is the InChIKey of 1-(4-chlorophenyl)sulfonyl-4,7-difluoro-3-methyl-2,3-dihydro-1H-indene?
The InChIKey is BQLDQNLXKDPKAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClF2O2S/c1-9-8-14(16-13(19)7-6-12(18)15(9)16)22(20,21)11-4-2-10(17)3-5-11/h2-7,9,14H,8H2,1H3.
What are the key properties of 1-(4-chlorophenyl)sulfonyl-4,7-difluoro-3-methyl-2,3-dihydro-1H-indene?
1-(4-chlorophenyl)sulfonyl-4,7-difluoro-3-methyl-2,3-dihydro-1H-indene has a molecular weight of 342.79 g/mol, XLogP of 4.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)sulfonyl-4,7-difluoro-3-methyl-2,3-dihydro-1H-indene is sourced from PubChem (CID 24875987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).