C19H17ClF2O3S — CID 24876170
(6aR,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromene (PubChem CID 24876170) has the molecular formula C19H17ClF2O3S and a molecular weight of 398.86 g/mol. Its IUPAC name is (6aR,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromene.
| Compound Name | (6aR,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 24876170 |
| Molecular Formula | C19H17ClF2O3S |
| Molecular Weight | 398.86 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | (6aR,10aS)-10a-(4-chlorophenyl)sulfonyl-1,4-difluoro-6,6a,7,8,9,10-hexahydrobenzo[c]chromene |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)[C@@]12CCCC[C@@H]1COc1c(F)ccc(F)c12 |
| InChI | InChI=1S/C19H17ClF2O3S/c20-13-4-6-14(7-5-13)26(23,24)19-10-2-1-3-12(19)11-25-18-16(22)9-8-15(21)17(18)19/h4-9,12H,1-3,10-11H2/t12-,19+/m1/s1 |
| InChIKey | WKJIHCVSKHHQDA-BLVKFPJESA-N |
| XLogP | 4.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.86 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |