About (4-amino-3,5-diethylphenyl) thiocyanate
(4-amino-3,5-diethylphenyl) thiocyanate (PubChem CID 2487666) has the molecular formula C11H14N2S
and a molecular weight of 206.31 g/mol. Its IUPAC name is (4-amino-3,5-diethylphenyl) thiocyanate.
Molecular Properties
| Compound Name | (4-amino-3,5-diethylphenyl) thiocyanate |
| PubChem CID | 2487666 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (4-amino-3,5-diethylphenyl) thiocyanate |
| SMILES | CCc1cc(SC#N)cc(CC)c1N |
| InChI | InChI=1S/C11H14N2S/c1-3-8-5-10(14-7-12)6-9(4-2)11(8)13/h5-6H,3-4,13H2,1-2H3 |
| InChIKey | VEJZYNJKGCWYKE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-3,5-diethylphenyl) thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-3,5-diethylphenyl) thiocyanate?
The IUPAC name of (4-amino-3,5-diethylphenyl) thiocyanate (CID 2487666) is (4-amino-3,5-diethylphenyl) thiocyanate.
What is the SMILES notation for (4-amino-3,5-diethylphenyl) thiocyanate?
The canonical SMILES for (4-amino-3,5-diethylphenyl) thiocyanate is CCc1cc(SC#N)cc(CC)c1N.
What is the InChIKey of (4-amino-3,5-diethylphenyl) thiocyanate?
The InChIKey is VEJZYNJKGCWYKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2S/c1-3-8-5-10(14-7-12)6-9(4-2)11(8)13/h5-6H,3-4,13H2,1-2H3.
What are the key properties of (4-amino-3,5-diethylphenyl) thiocyanate?
(4-amino-3,5-diethylphenyl) thiocyanate has a molecular weight of 206.31 g/mol, XLogP of 2.97, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-3,5-diethylphenyl) thiocyanate is sourced from PubChem (CID 2487666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).