C50H68N2O3 — CID 24877301
N-[(2R)-2-[2,2-bis(4-tert-butylphenyl)ethyl-hydroxyamino]cyclohexyl]-2,2-bis(4-tert-butylphenyl)-N-hydroxyacetamide (PubChem CID 24877301) has the molecular formula C50H68N2O3 and a molecular weight of 745.10 g/mol. Its IUPAC name is N-[(2R)-2-[2,2-bis(4-tert-butylphenyl)ethyl-hydroxyamino]cyclohexyl]-2,2-bis(4-tert-butylphenyl)-N-hydroxyacetamide.
| Compound Name | N-[(2R)-2-[2,2-bis(4-tert-butylphenyl)ethyl-hydroxyamino]cyclohexyl]-2,2-bis(4-tert-butylphenyl)-N-hydroxyacetamide |
|---|---|
| PubChem CID | 24877301 |
| Molecular Formula | C50H68N2O3 |
| Molecular Weight | 745.10 g/mol |
| Exact Mass | 744.52 |
| IUPAC Name | N-[(2R)-2-[2,2-bis(4-tert-butylphenyl)ethyl-hydroxyamino]cyclohexyl]-2,2-bis(4-tert-butylphenyl)-N-hydroxyacetamide |
| SMILES | CC(C)(C)c1ccc(C(CN(O)[C@@H]2CCCCC2N(O)C(=O)C(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C50H68N2O3/c1-47(2,3)38-25-17-34(18-26-38)42(35-19-27-39(28-20-35)48(4,5)6)33-51(54)43-15-13-14-16-44(43)52(55)46(53)45(36-21-29-40(30-22-36)49(7,8)9)37-23-31-41(32-24-37)50(10,11)12/h17-32,42-45,54-55H,13-16,33H2,1-12H3/t43-,44?/m1/s1 |
| InChIKey | FOGFZBNVMMKSJR-WARULYAYSA-N |
| XLogP | 12.06 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.10 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|