C22H19N3O2S — CID 24878399
[3-[[2-(2-aminopyrimidin-4-yl)-3-methyl-1-benzothiophen-5-yl]methyl]phenyl] acetate (PubChem CID 24878399) has the molecular formula C22H19N3O2S and a molecular weight of 389.48 g/mol. Its IUPAC name is [3-[[2-(2-aminopyrimidin-4-yl)-3-methyl-1-benzothiophen-5-yl]methyl]phenyl] acetate.
| Compound Name | [3-[[2-(2-aminopyrimidin-4-yl)-3-methyl-1-benzothiophen-5-yl]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 24878399 |
| Molecular Formula | C22H19N3O2S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | [3-[[2-(2-aminopyrimidin-4-yl)-3-methyl-1-benzothiophen-5-yl]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(Cc2ccc3sc(-c4ccnc(N)n4)c(C)c3c2)c1 |
| InChI | InChI=1S/C22H19N3O2S/c1-13-18-12-16(10-15-4-3-5-17(11-15)27-14(2)26)6-7-20(18)28-21(13)19-8-9-24-22(23)25-19/h3-9,11-12H,10H2,1-2H3,(H2,23,24,25) |
| InChIKey | QKFGVEFNJIJWGN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|