About dichloronickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine
dichloronickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine (PubChem CID 24878702) has the molecular formula C12H12Cl2N2NiO2
and a molecular weight of 345.84 g/mol. Its IUPAC name is dichloronickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine.
Molecular Properties
| Compound Name | dichloronickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine |
| PubChem CID | 24878702 |
| Molecular Formula | C12H12Cl2N2NiO2 |
| Molecular Weight | 345.84 g/mol |
| Exact Mass | 343.96 |
| IUPAC Name | dichloronickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine |
| SMILES | COc1ccnc(-c2cc(OC)ccn2)c1.Cl[Ni]Cl |
| InChI | InChI=1S/C12H12N2O2.2ClH.Ni/c1-15-9-3-5-13-11(7-9)12-8-10(16-2)4-6-14-12;;;/h3-8H,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | FMXCYJMTCRBSOJ-UHFFFAOYSA-L |
| XLogP | 3.54 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.84 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dichloronickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloronickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine?
The IUPAC name of dichloronickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine (CID 24878702) is dichloronickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine.
What is the SMILES notation for dichloronickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine?
The canonical SMILES for dichloronickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine is COc1ccnc(-c2cc(OC)ccn2)c1.Cl[Ni]Cl.
What is the InChIKey of dichloronickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine?
The InChIKey is FMXCYJMTCRBSOJ-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H12N2O2.2ClH.Ni/c1-15-9-3-5-13-11(7-9)12-8-10(16-2)4-6-14-12;;;/h3-8H,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichloronickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine?
dichloronickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine has a molecular weight of 345.84 g/mol, XLogP of 3.54, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichloronickel;4-methoxy-2-(4-methoxy-2-pyridinyl)pyridine is sourced from PubChem (CID 24878702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).