About 6-ethyl-5-hydroxy-8,8-dimethyl-2-phenylchromene-4,7-dione
6-ethyl-5-hydroxy-8,8-dimethyl-2-phenylchromene-4,7-dione (PubChem CID 24878729) has the molecular formula C19H18O4
and a molecular weight of 310.35 g/mol. Its IUPAC name is 6-ethyl-5-hydroxy-8,8-dimethyl-2-phenylchromene-4,7-dione.
Molecular Properties
| Compound Name | 6-ethyl-5-hydroxy-8,8-dimethyl-2-phenylchromene-4,7-dione |
| PubChem CID | 24878729 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 6-ethyl-5-hydroxy-8,8-dimethyl-2-phenylchromene-4,7-dione |
| SMILES | CCC1=C(O)c2c(oc(-c3ccccc3)cc2=O)C(C)(C)C1=O |
| InChI | InChI=1S/C19H18O4/c1-4-12-16(21)15-13(20)10-14(11-8-6-5-7-9-11)23-18(15)19(2,3)17(12)22/h5-10,21H,4H2,1-3H3 |
| InChIKey | IWDCJDFXFMAUEY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-ethyl-5-hydroxy-8,8-dimethyl-2-phenylchromene-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-5-hydroxy-8,8-dimethyl-2-phenylchromene-4,7-dione?
The IUPAC name of 6-ethyl-5-hydroxy-8,8-dimethyl-2-phenylchromene-4,7-dione (CID 24878729) is 6-ethyl-5-hydroxy-8,8-dimethyl-2-phenylchromene-4,7-dione.
What is the SMILES notation for 6-ethyl-5-hydroxy-8,8-dimethyl-2-phenylchromene-4,7-dione?
The canonical SMILES for 6-ethyl-5-hydroxy-8,8-dimethyl-2-phenylchromene-4,7-dione is CCC1=C(O)c2c(oc(-c3ccccc3)cc2=O)C(C)(C)C1=O.
What is the InChIKey of 6-ethyl-5-hydroxy-8,8-dimethyl-2-phenylchromene-4,7-dione?
The InChIKey is IWDCJDFXFMAUEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O4/c1-4-12-16(21)15-13(20)10-14(11-8-6-5-7-9-11)23-18(15)19(2,3)17(12)22/h5-10,21H,4H2,1-3H3.
What are the key properties of 6-ethyl-5-hydroxy-8,8-dimethyl-2-phenylchromene-4,7-dione?
6-ethyl-5-hydroxy-8,8-dimethyl-2-phenylchromene-4,7-dione has a molecular weight of 310.35 g/mol, XLogP of 3.85, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-5-hydroxy-8,8-dimethyl-2-phenylchromene-4,7-dione is sourced from PubChem (CID 24878729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).