C23H26O4 — CID 24878730
6,8,8-triethyl-2-(4-ethylphenyl)-5-hydroxychromene-4,7-dione (PubChem CID 24878730) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is 6,8,8-triethyl-2-(4-ethylphenyl)-5-hydroxychromene-4,7-dione.
| Compound Name | 6,8,8-triethyl-2-(4-ethylphenyl)-5-hydroxychromene-4,7-dione |
|---|---|
| PubChem CID | 24878730 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 6,8,8-triethyl-2-(4-ethylphenyl)-5-hydroxychromene-4,7-dione |
| SMILES | CCC1=C(O)c2c(oc(-c3ccc(CC)cc3)cc2=O)C(CC)(CC)C1=O |
| InChI | InChI=1S/C23H26O4/c1-5-14-9-11-15(12-10-14)18-13-17(24)19-20(25)16(6-2)21(26)23(7-3,8-4)22(19)27-18/h9-13,25H,5-8H2,1-4H3 |
| InChIKey | RUWYEHQXZCJQKX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |